C16H19F3N2O — CID 146568432
1-[3-ethyl-3-[3-(trifluoromethyl)anilino]pyrrolidin-1-yl]prop-2-en-1-one (PubChem CID 146568432) has the molecular formula C16H19F3N2O and a molecular weight of 312.34 g/mol. Its IUPAC name is 1-[3-ethyl-3-[3-(trifluoromethyl)anilino]pyrrolidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[3-ethyl-3-[3-(trifluoromethyl)anilino]pyrrolidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 146568432 |
| Molecular Formula | C16H19F3N2O |
| Molecular Weight | 312.34 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 1-[3-ethyl-3-[3-(trifluoromethyl)anilino]pyrrolidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC(CC)(Nc2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C16H19F3N2O/c1-3-14(22)21-9-8-15(4-2,11-21)20-13-7-5-6-12(10-13)16(17,18)19/h3,5-7,10,20H,1,4,8-9,11H2,2H3 |
| InChIKey | UHJQOWRWQOZBMO-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.34 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|