C18H24F3N3O — CID 146567821
(E)-4-(dimethylamino)-1-[3-methyl-3-[3-(trifluoromethyl)anilino]pyrrolidin-1-yl]but-2-en-1-one (PubChem CID 146567821) has the molecular formula C18H24F3N3O and a molecular weight of 355.40 g/mol. Its IUPAC name is (E)-4-(dimethylamino)-1-[3-methyl-3-[3-(trifluoromethyl)anilino]pyrrolidin-1-yl]but-2-en-1-one.
| Compound Name | (E)-4-(dimethylamino)-1-[3-methyl-3-[3-(trifluoromethyl)anilino]pyrrolidin-1-yl]but-2-en-1-one |
|---|---|
| PubChem CID | 146567821 |
| Molecular Formula | C18H24F3N3O |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | (E)-4-(dimethylamino)-1-[3-methyl-3-[3-(trifluoromethyl)anilino]pyrrolidin-1-yl]but-2-en-1-one |
| SMILES | CN(C)C/C=C/C(=O)N1CCC(C)(Nc2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C18H24F3N3O/c1-17(22-15-7-4-6-14(12-15)18(19,20)21)9-11-24(13-17)16(25)8-5-10-23(2)3/h4-8,12,22H,9-11,13H2,1-3H3/b8-5+ |
| InChIKey | ORFUHGGKUVHVPE-VMPITWQZSA-N |
| XLogP | 3.23 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|