C18H16F3N3O2 — CID 162582437
(E)-4-(dimethylamino)-1-[6-[3-(trifluoromethyl)phenyl]imidazo[2,1-b][1,3]oxazol-5-yl]but-2-en-1-one (PubChem CID 162582437) has the molecular formula C18H16F3N3O2 and a molecular weight of 363.34 g/mol. Its IUPAC name is (E)-4-(dimethylamino)-1-[6-[3-(trifluoromethyl)phenyl]imidazo[2,1-b][1,3]oxazol-5-yl]but-2-en-1-one.
| Compound Name | (E)-4-(dimethylamino)-1-[6-[3-(trifluoromethyl)phenyl]imidazo[2,1-b][1,3]oxazol-5-yl]but-2-en-1-one |
|---|---|
| PubChem CID | 162582437 |
| Molecular Formula | C18H16F3N3O2 |
| Molecular Weight | 363.34 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | (E)-4-(dimethylamino)-1-[6-[3-(trifluoromethyl)phenyl]imidazo[2,1-b][1,3]oxazol-5-yl]but-2-en-1-one |
| SMILES | CN(C)C/C=C/C(=O)c1c(-c2cccc(C(F)(F)F)c2)nc2occn12 |
| InChI | InChI=1S/C18H16F3N3O2/c1-23(2)8-4-7-14(25)16-15(22-17-24(16)9-10-26-17)12-5-3-6-13(11-12)18(19,20)21/h3-7,9-11H,8H2,1-2H3/b7-4+ |
| InChIKey | QAKBCWAGAQMHMS-QPJJXVBHSA-N |
| XLogP | 3.91 |
| TPSA | 50.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.34 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|