C16H11F3N2O2 — CID 143219736
(E)-1-[6-[3-(trifluoromethyl)phenyl]imidazo[2,1-b][1,3]oxazol-5-yl]but-2-en-1-one (PubChem CID 143219736) has the molecular formula C16H11F3N2O2 and a molecular weight of 320.27 g/mol. Its IUPAC name is (E)-1-[6-[3-(trifluoromethyl)phenyl]imidazo[2,1-b][1,3]oxazol-5-yl]but-2-en-1-one.
| Compound Name | (E)-1-[6-[3-(trifluoromethyl)phenyl]imidazo[2,1-b][1,3]oxazol-5-yl]but-2-en-1-one |
|---|---|
| PubChem CID | 143219736 |
| Molecular Formula | C16H11F3N2O2 |
| Molecular Weight | 320.27 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | (E)-1-[6-[3-(trifluoromethyl)phenyl]imidazo[2,1-b][1,3]oxazol-5-yl]but-2-en-1-one |
| SMILES | C/C=C/C(=O)c1c(-c2cccc(C(F)(F)F)c2)nc2occn12 |
| InChI | InChI=1S/C16H11F3N2O2/c1-2-4-12(22)14-13(20-15-21(14)7-8-23-15)10-5-3-6-11(9-10)16(17,18)19/h2-9H,1H3/b4-2+ |
| InChIKey | YNZXVJNOVPJCNW-DUXPYHPUSA-N |
| XLogP | 4.37 |
| TPSA | 47.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.27 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|