C21H17F3N2O2 — CID 58004358
2-methyl-2-[6-[6-[3-(trifluoromethyl)phenyl]-2-pyridinyl]-2-pyridinyl]propanoic acid (PubChem CID 58004358) has the molecular formula C21H17F3N2O2 and a molecular weight of 386.37 g/mol. Its IUPAC name is 2-methyl-2-[6-[6-[3-(trifluoromethyl)phenyl]-2-pyridinyl]-2-pyridinyl]propanoic acid.
| Compound Name | 2-methyl-2-[6-[6-[3-(trifluoromethyl)phenyl]-2-pyridinyl]-2-pyridinyl]propanoic acid |
|---|---|
| PubChem CID | 58004358 |
| Molecular Formula | C21H17F3N2O2 |
| Molecular Weight | 386.37 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | 2-methyl-2-[6-[6-[3-(trifluoromethyl)phenyl]-2-pyridinyl]-2-pyridinyl]propanoic acid |
| SMILES | CC(C)(C(=O)O)c1cccc(-c2cccc(-c3cccc(C(F)(F)F)c3)n2)n1 |
| InChI | InChI=1S/C21H17F3N2O2/c1-20(2,19(27)28)18-11-5-10-17(26-18)16-9-4-8-15(25-16)13-6-3-7-14(12-13)21(22,23)24/h3-12H,1-2H3,(H,27,28) |
| InChIKey | SCWMOJYSTGUCOB-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.37 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |