C21H17F3N2O2 — CID 66857601
3-[6-[2-[3-(trifluoromethyl)phenyl]ethylamino]-2-pyridinyl]benzoic acid (PubChem CID 66857601) has the molecular formula C21H17F3N2O2 and a molecular weight of 386.37 g/mol. Its IUPAC name is 3-[6-[2-[3-(trifluoromethyl)phenyl]ethylamino]-2-pyridinyl]benzoic acid.
| Compound Name | 3-[6-[2-[3-(trifluoromethyl)phenyl]ethylamino]-2-pyridinyl]benzoic acid |
|---|---|
| PubChem CID | 66857601 |
| Molecular Formula | C21H17F3N2O2 |
| Molecular Weight | 386.37 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | 3-[6-[2-[3-(trifluoromethyl)phenyl]ethylamino]-2-pyridinyl]benzoic acid |
| SMILES | O=C(O)c1cccc(-c2cccc(NCCc3cccc(C(F)(F)F)c3)n2)c1 |
| InChI | InChI=1S/C21H17F3N2O2/c22-21(23,24)17-7-1-4-14(12-17)10-11-25-19-9-3-8-18(26-19)15-5-2-6-16(13-15)20(27)28/h1-9,12-13H,10-11H2,(H,25,26)(H,27,28) |
| InChIKey | PBPDGPNUPWGVPV-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.37 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |