C21H13F6NO2 — CID 134623875
2-[3,6-bis[3-(trifluoromethyl)phenyl]-2-pyridinyl]acetic acid (PubChem CID 134623875) has the molecular formula C21H13F6NO2 and a molecular weight of 425.33 g/mol. Its IUPAC name is 2-[3,6-bis[3-(trifluoromethyl)phenyl]-2-pyridinyl]acetic acid.
| Compound Name | 2-[3,6-bis[3-(trifluoromethyl)phenyl]-2-pyridinyl]acetic acid |
|---|---|
| PubChem CID | 134623875 |
| Molecular Formula | C21H13F6NO2 |
| Molecular Weight | 425.33 g/mol |
| Exact Mass | 425.09 |
| IUPAC Name | 2-[3,6-bis[3-(trifluoromethyl)phenyl]-2-pyridinyl]acetic acid |
| SMILES | O=C(O)Cc1nc(-c2cccc(C(F)(F)F)c2)ccc1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H13F6NO2/c22-20(23,24)14-5-1-3-12(9-14)16-7-8-17(28-18(16)11-19(29)30)13-4-2-6-15(10-13)21(25,26)27/h1-10H,11H2,(H,29,30) |
| InChIKey | YNULACXGPAZNSS-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.33 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |