C14H11F3N2O2 — CID 119001070
2-[2-amino-3-[3-(trifluoromethyl)phenyl]-4-pyridinyl]acetic acid (PubChem CID 119001070) has the molecular formula C14H11F3N2O2 and a molecular weight of 296.25 g/mol. Its IUPAC name is 2-[2-amino-3-[3-(trifluoromethyl)phenyl]-4-pyridinyl]acetic acid.
| Compound Name | 2-[2-amino-3-[3-(trifluoromethyl)phenyl]-4-pyridinyl]acetic acid |
|---|---|
| PubChem CID | 119001070 |
| Molecular Formula | C14H11F3N2O2 |
| Molecular Weight | 296.25 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 2-[2-amino-3-[3-(trifluoromethyl)phenyl]-4-pyridinyl]acetic acid |
| SMILES | Nc1nccc(CC(=O)O)c1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H11F3N2O2/c15-14(16,17)10-3-1-2-8(6-10)12-9(7-11(20)21)4-5-19-13(12)18/h1-6H,7H2,(H2,18,19)(H,20,21) |
| InChIKey | GJQPMPLMHIXTDC-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.25 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |