C19H13F2NO2 — CID 131869699
2-[3,6-bis(4-fluorophenyl)-2-pyridinyl]acetic acid (PubChem CID 131869699) has the molecular formula C19H13F2NO2 and a molecular weight of 325.31 g/mol. Its IUPAC name is 2-[3,6-bis(4-fluorophenyl)-2-pyridinyl]acetic acid.
| Compound Name | 2-[3,6-bis(4-fluorophenyl)-2-pyridinyl]acetic acid |
|---|---|
| PubChem CID | 131869699 |
| Molecular Formula | C19H13F2NO2 |
| Molecular Weight | 325.31 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | 2-[3,6-bis(4-fluorophenyl)-2-pyridinyl]acetic acid |
| SMILES | O=C(O)Cc1nc(-c2ccc(F)cc2)ccc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C19H13F2NO2/c20-14-5-1-12(2-6-14)16-9-10-17(22-18(16)11-19(23)24)13-3-7-15(21)8-4-13/h1-10H,11H2,(H,23,24) |
| InChIKey | XXQNMENJTRQDNB-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.31 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |