C19H14F3NO2 — CID 3928035
8-ethyl-2-[3-(trifluoromethyl)phenyl]quinoline-4-carboxylic acid (PubChem CID 3928035) has the molecular formula C19H14F3NO2 and a molecular weight of 345.32 g/mol. Its IUPAC name is 8-ethyl-2-[3-(trifluoromethyl)phenyl]quinoline-4-carboxylic acid.
| Compound Name | 8-ethyl-2-[3-(trifluoromethyl)phenyl]quinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 3928035 |
| Molecular Formula | C19H14F3NO2 |
| Molecular Weight | 345.32 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | 8-ethyl-2-[3-(trifluoromethyl)phenyl]quinoline-4-carboxylic acid |
| SMILES | CCc1cccc2c(C(=O)O)cc(-c3cccc(C(F)(F)F)c3)nc12 |
| InChI | InChI=1S/C19H14F3NO2/c1-2-11-5-4-8-14-15(18(24)25)10-16(23-17(11)14)12-6-3-7-13(9-12)19(20,21)22/h3-10H,2H2,1H3,(H,24,25) |
| InChIKey | AIULODXJNRZVLE-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.32 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |