C18H13NO4 — CID 71039932
8-(carboxymethyl)-2-phenylquinoline-4-carboxylic acid (PubChem CID 71039932) has the molecular formula C18H13NO4 and a molecular weight of 307.31 g/mol. Its IUPAC name is 8-(carboxymethyl)-2-phenylquinoline-4-carboxylic acid.
| Compound Name | 8-(carboxymethyl)-2-phenylquinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 71039932 |
| Molecular Formula | C18H13NO4 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | 8-(carboxymethyl)-2-phenylquinoline-4-carboxylic acid |
| SMILES | O=C(O)Cc1cccc2c(C(=O)O)cc(-c3ccccc3)nc12 |
| InChI | InChI=1S/C18H13NO4/c20-16(21)9-12-7-4-8-13-14(18(22)23)10-15(19-17(12)13)11-5-2-1-3-6-11/h1-8,10H,9H2,(H,20,21)(H,22,23) |
| InChIKey | QAHLKUTWTSWXPC-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 87.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |