C15H18F3N3S — CID 143932945
ethane;5-methyl-2-methylsulfanyl-6-[3-(trifluoromethyl)phenyl]pyrimidin-4-amine (PubChem CID 143932945) has the molecular formula C15H18F3N3S and a molecular weight of 329.39 g/mol. Its IUPAC name is ethane;5-methyl-2-methylsulfanyl-6-[3-(trifluoromethyl)phenyl]pyrimidin-4-amine.
| Compound Name | ethane;5-methyl-2-methylsulfanyl-6-[3-(trifluoromethyl)phenyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 143932945 |
| Molecular Formula | C15H18F3N3S |
| Molecular Weight | 329.39 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | ethane;5-methyl-2-methylsulfanyl-6-[3-(trifluoromethyl)phenyl]pyrimidin-4-amine |
| SMILES | CC.CSc1nc(N)c(C)c(-c2cccc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C13H12F3N3S.C2H6/c1-7-10(18-12(20-2)19-11(7)17)8-4-3-5-9(6-8)13(14,15)16;1-2/h3-6H,1-2H3,(H2,17,18,19);1-2H3 |
| InChIKey | GKLFODOAWCGOEZ-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.39 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |