C16H11F3N4S — CID 18317248
2-methylsulfanyl-4-[3-[3-(trifluoromethyl)phenyl]pyrazin-2-yl]pyrimidine (PubChem CID 18317248) has the molecular formula C16H11F3N4S and a molecular weight of 348.35 g/mol. Its IUPAC name is 2-methylsulfanyl-4-[3-[3-(trifluoromethyl)phenyl]pyrazin-2-yl]pyrimidine.
| Compound Name | 2-methylsulfanyl-4-[3-[3-(trifluoromethyl)phenyl]pyrazin-2-yl]pyrimidine |
|---|---|
| PubChem CID | 18317248 |
| Molecular Formula | C16H11F3N4S |
| Molecular Weight | 348.35 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | 2-methylsulfanyl-4-[3-[3-(trifluoromethyl)phenyl]pyrazin-2-yl]pyrimidine |
| SMILES | CSc1nccc(-c2nccnc2-c2cccc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C16H11F3N4S/c1-24-15-22-6-5-12(23-15)14-13(20-7-8-21-14)10-3-2-4-11(9-10)16(17,18)19/h2-9H,1H3 |
| InChIKey | ZCSKTVMXDAIZRO-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.35 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |