C17H23F2N3O2 — CID 156549050
1-[3-[3-[1,1-difluoro-2-hydroxy-2-(methylamino)ethyl]anilino]-3-methylpyrrolidin-1-yl]prop-2-en-1-one (PubChem CID 156549050) has the molecular formula C17H23F2N3O2 and a molecular weight of 339.39 g/mol. Its IUPAC name is 1-[3-[3-[1,1-difluoro-2-hydroxy-2-(methylamino)ethyl]anilino]-3-methylpyrrolidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[3-[3-[1,1-difluoro-2-hydroxy-2-(methylamino)ethyl]anilino]-3-methylpyrrolidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 156549050 |
| Molecular Formula | C17H23F2N3O2 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | 1-[3-[3-[1,1-difluoro-2-hydroxy-2-(methylamino)ethyl]anilino]-3-methylpyrrolidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC(C)(Nc2cccc(C(F)(F)C(O)NC)c2)C1 |
| InChI | InChI=1S/C17H23F2N3O2/c1-4-14(23)22-9-8-16(2,11-22)21-13-7-5-6-12(10-13)17(18,19)15(24)20-3/h4-7,10,15,20-21,24H,1,8-9,11H2,2-3H3 |
| InChIKey | ZOOYLYJCRWRYFW-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|