C21H24F2N2O — CID 166130038
1-[7-[3-(1,1-difluoropropyl)anilino]-3,4-dihydro-1H-isoquinolin-2-yl]prop-2-en-1-one;molecular hydrogen (PubChem CID 166130038) has the molecular formula C21H24F2N2O and a molecular weight of 358.43 g/mol. Its IUPAC name is 1-[7-[3-(1,1-difluoropropyl)anilino]-3,4-dihydro-1H-isoquinolin-2-yl]prop-2-en-1-one;molecular hydrogen.
| Compound Name | 1-[7-[3-(1,1-difluoropropyl)anilino]-3,4-dihydro-1H-isoquinolin-2-yl]prop-2-en-1-one;molecular hydrogen |
|---|---|
| PubChem CID | 166130038 |
| Molecular Formula | C21H24F2N2O |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | 1-[7-[3-(1,1-difluoropropyl)anilino]-3,4-dihydro-1H-isoquinolin-2-yl]prop-2-en-1-one;molecular hydrogen |
| SMILES | C=CC(=O)N1CCc2ccc(Nc3cccc(C(F)(F)CC)c3)cc2C1.[H][H] |
| InChI | InChI=1S/C21H22F2N2O.H2/c1-3-20(26)25-11-10-15-8-9-19(12-16(15)14-25)24-18-7-5-6-17(13-18)21(22,23)4-2;/h3,5-9,12-13,24H,1,4,10-11,14H2,2H3;1H |
| InChIKey | GXVGRZDFQUGPCK-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|