C21H17F3N4O2 — CID 172888637
N-(2-prop-2-enoyl-3,4-dihydro-1H-isoquinolin-6-yl)-5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine-3-carboxamide (PubChem CID 172888637) has the molecular formula C21H17F3N4O2 and a molecular weight of 414.39 g/mol. Its IUPAC name is N-(2-prop-2-enoyl-3,4-dihydro-1H-isoquinolin-6-yl)-5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine-3-carboxamide.
| Compound Name | N-(2-prop-2-enoyl-3,4-dihydro-1H-isoquinolin-6-yl)-5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 172888637 |
| Molecular Formula | C21H17F3N4O2 |
| Molecular Weight | 414.39 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | N-(2-prop-2-enoyl-3,4-dihydro-1H-isoquinolin-6-yl)-5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine-3-carboxamide |
| SMILES | C=CC(=O)N1CCc2cc(NC(=O)c3c[nH]c4ncc(C(F)(F)F)cc34)ccc2C1 |
| InChI | InChI=1S/C21H17F3N4O2/c1-2-18(29)28-6-5-12-7-15(4-3-13(12)11-28)27-20(30)17-10-26-19-16(17)8-14(9-25-19)21(22,23)24/h2-4,7-10H,1,5-6,11H2,(H,25,26)(H,27,30) |
| InChIKey | RIGZPYLQRJOQDD-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.39 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|