C18H15F3N2O2 — CID 166129983
1-[7-[[5-(trifluoromethyl)-2-pyridinyl]oxy]-3,4-dihydro-1H-isoquinolin-2-yl]prop-2-en-1-one (PubChem CID 166129983) has the molecular formula C18H15F3N2O2 and a molecular weight of 348.32 g/mol. Its IUPAC name is 1-[7-[[5-(trifluoromethyl)-2-pyridinyl]oxy]-3,4-dihydro-1H-isoquinolin-2-yl]prop-2-en-1-one.
| Compound Name | 1-[7-[[5-(trifluoromethyl)-2-pyridinyl]oxy]-3,4-dihydro-1H-isoquinolin-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 166129983 |
| Molecular Formula | C18H15F3N2O2 |
| Molecular Weight | 348.32 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 1-[7-[[5-(trifluoromethyl)-2-pyridinyl]oxy]-3,4-dihydro-1H-isoquinolin-2-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCc2ccc(Oc3ccc(C(F)(F)F)cn3)cc2C1 |
| InChI | InChI=1S/C18H15F3N2O2/c1-2-17(24)23-8-7-12-3-5-15(9-13(12)11-23)25-16-6-4-14(10-22-16)18(19,20)21/h2-6,9-10H,1,7-8,11H2 |
| InChIKey | KJHAETTYEWIPDT-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.32 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|