C19H16N2O2 — CID 166130003
3-[(2-prop-2-enoyl-3,4-dihydro-1H-isoquinolin-7-yl)oxy]benzonitrile (PubChem CID 166130003) has the molecular formula C19H16N2O2 and a molecular weight of 304.35 g/mol. Its IUPAC name is 3-[(2-prop-2-enoyl-3,4-dihydro-1H-isoquinolin-7-yl)oxy]benzonitrile.
| Compound Name | 3-[(2-prop-2-enoyl-3,4-dihydro-1H-isoquinolin-7-yl)oxy]benzonitrile |
|---|---|
| PubChem CID | 166130003 |
| Molecular Formula | C19H16N2O2 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 3-[(2-prop-2-enoyl-3,4-dihydro-1H-isoquinolin-7-yl)oxy]benzonitrile |
| SMILES | C=CC(=O)N1CCc2ccc(Oc3cccc(C#N)c3)cc2C1 |
| InChI | InChI=1S/C19H16N2O2/c1-2-19(22)21-9-8-15-6-7-18(11-16(15)13-21)23-17-5-3-4-14(10-17)12-20/h2-7,10-11H,1,8-9,13H2 |
| InChIKey | BQMCGLZGMPPRPL-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|