C18H20N4O3 — CID 172888807
1-[7-[(4,6-dimethoxypyrimidin-2-yl)amino]-3,4-dihydro-1H-isoquinolin-2-yl]prop-2-en-1-one (PubChem CID 172888807) has the molecular formula C18H20N4O3 and a molecular weight of 340.38 g/mol. Its IUPAC name is 1-[7-[(4,6-dimethoxypyrimidin-2-yl)amino]-3,4-dihydro-1H-isoquinolin-2-yl]prop-2-en-1-one.
| Compound Name | 1-[7-[(4,6-dimethoxypyrimidin-2-yl)amino]-3,4-dihydro-1H-isoquinolin-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 172888807 |
| Molecular Formula | C18H20N4O3 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 1-[7-[(4,6-dimethoxypyrimidin-2-yl)amino]-3,4-dihydro-1H-isoquinolin-2-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCc2ccc(Nc3nc(OC)cc(OC)n3)cc2C1 |
| InChI | InChI=1S/C18H20N4O3/c1-4-17(23)22-8-7-12-5-6-14(9-13(12)11-22)19-18-20-15(24-2)10-16(21-18)25-3/h4-6,9-10H,1,7-8,11H2,2-3H3,(H,19,20,21) |
| InChIKey | CALDJEVCWZQEGO-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|