C18H16ClNO2 — CID 166130044
1-[7-(3-chlorophenoxy)-3,4-dihydro-1H-isoquinolin-2-yl]prop-2-en-1-one (PubChem CID 166130044) has the molecular formula C18H16ClNO2 and a molecular weight of 313.78 g/mol. Its IUPAC name is 1-[7-(3-chlorophenoxy)-3,4-dihydro-1H-isoquinolin-2-yl]prop-2-en-1-one.
| Compound Name | 1-[7-(3-chlorophenoxy)-3,4-dihydro-1H-isoquinolin-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 166130044 |
| Molecular Formula | C18H16ClNO2 |
| Molecular Weight | 313.78 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | 1-[7-(3-chlorophenoxy)-3,4-dihydro-1H-isoquinolin-2-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCc2ccc(Oc3cccc(Cl)c3)cc2C1 |
| InChI | InChI=1S/C18H16ClNO2/c1-2-18(21)20-9-8-13-6-7-17(10-14(13)12-20)22-16-5-3-4-15(19)11-16/h2-7,10-11H,1,8-9,12H2 |
| InChIKey | XDKVHYFRARPBNK-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.78 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|