C20H18F3NO3 — CID 169116381
prop-1-en-2-yl 7-[4-(trifluoromethyl)phenoxy]-3,4-dihydro-1H-isoquinoline-2-carboxylate (PubChem CID 169116381) has the molecular formula C20H18F3NO3 and a molecular weight of 377.36 g/mol. Its IUPAC name is prop-1-en-2-yl 7-[4-(trifluoromethyl)phenoxy]-3,4-dihydro-1H-isoquinoline-2-carboxylate.
| Compound Name | prop-1-en-2-yl 7-[4-(trifluoromethyl)phenoxy]-3,4-dihydro-1H-isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 169116381 |
| Molecular Formula | C20H18F3NO3 |
| Molecular Weight | 377.36 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | prop-1-en-2-yl 7-[4-(trifluoromethyl)phenoxy]-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| SMILES | C=C(C)OC(=O)N1CCc2ccc(Oc3ccc(C(F)(F)F)cc3)cc2C1 |
| InChI | InChI=1S/C20H18F3NO3/c1-13(2)26-19(25)24-10-9-14-3-6-18(11-15(14)12-24)27-17-7-4-16(5-8-17)20(21,22)23/h3-8,11H,1,9-10,12H2,2H3 |
| InChIKey | CVLBFCMEJWVHAB-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.36 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|