C20H16F3NO4 — CID 174238128
2-prop-2-enoyl-7-[4-(trifluoromethyl)phenoxy]-3,4-dihydro-1H-isoquinoline-3-carboxylic acid (PubChem CID 174238128) has the molecular formula C20H16F3NO4 and a molecular weight of 391.35 g/mol. Its IUPAC name is 2-prop-2-enoyl-7-[4-(trifluoromethyl)phenoxy]-3,4-dihydro-1H-isoquinoline-3-carboxylic acid.
| Compound Name | 2-prop-2-enoyl-7-[4-(trifluoromethyl)phenoxy]-3,4-dihydro-1H-isoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 174238128 |
| Molecular Formula | C20H16F3NO4 |
| Molecular Weight | 391.35 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | 2-prop-2-enoyl-7-[4-(trifluoromethyl)phenoxy]-3,4-dihydro-1H-isoquinoline-3-carboxylic acid |
| SMILES | C=CC(=O)N1Cc2cc(Oc3ccc(C(F)(F)F)cc3)ccc2CC1C(=O)O |
| InChI | InChI=1S/C20H16F3NO4/c1-2-18(25)24-11-13-9-16(6-3-12(13)10-17(24)19(26)27)28-15-7-4-14(5-8-15)20(21,22)23/h2-9,17H,1,10-11H2,(H,26,27) |
| InChIKey | SMUYPCSHGYYUHM-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.35 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|