C18H17ClN4O — CID 166362984
6-chloro-N-(2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)-1H-pyrrolo[2,3-b]pyridine-3-carboxamide (PubChem CID 166362984) has the molecular formula C18H17ClN4O and a molecular weight of 340.81 g/mol. Its IUPAC name is 6-chloro-N-(2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)-1H-pyrrolo[2,3-b]pyridine-3-carboxamide.
| Compound Name | 6-chloro-N-(2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)-1H-pyrrolo[2,3-b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 166362984 |
| Molecular Formula | C18H17ClN4O |
| Molecular Weight | 340.81 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | 6-chloro-N-(2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)-1H-pyrrolo[2,3-b]pyridine-3-carboxamide |
| SMILES | CN1CCc2ccc(NC(=O)c3c[nH]c4nc(Cl)ccc34)cc2C1 |
| InChI | InChI=1S/C18H17ClN4O/c1-23-7-6-11-2-3-13(8-12(11)10-23)21-18(24)15-9-20-17-14(15)4-5-16(19)22-17/h2-5,8-9H,6-7,10H2,1H3,(H,20,22)(H,21,24) |
| InChIKey | GUGWIZUCUNEGPB-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.81 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|