About 2,4-difluoro-N-(2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)benzamide
2,4-difluoro-N-(2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)benzamide (PubChem CID 22597780) has the molecular formula C17H16F2N2O
and a molecular weight of 302.32 g/mol. Its IUPAC name is 2,4-difluoro-N-(2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)benzamide.
Molecular Properties
| Compound Name | 2,4-difluoro-N-(2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)benzamide |
| PubChem CID | 22597780 |
| Molecular Formula | C17H16F2N2O |
| Molecular Weight | 302.32 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 2,4-difluoro-N-(2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)benzamide |
| SMILES | CN1CCc2ccc(NC(=O)c3ccc(F)cc3F)cc2C1 |
| InChI | InChI=1S/C17H16F2N2O/c1-21-7-6-11-2-4-14(8-12(11)10-21)20-17(22)15-5-3-13(18)9-16(15)19/h2-5,8-9H,6-7,10H2,1H3,(H,20,22) |
| InChIKey | MBACTHKEPMCGMB-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.32 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,4-difluoro-N-(2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-difluoro-N-(2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)benzamide?
The IUPAC name of 2,4-difluoro-N-(2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)benzamide (CID 22597780) is 2,4-difluoro-N-(2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)benzamide.
What is the SMILES notation for 2,4-difluoro-N-(2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)benzamide?
The canonical SMILES for 2,4-difluoro-N-(2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)benzamide is CN1CCc2ccc(NC(=O)c3ccc(F)cc3F)cc2C1.
What is the InChIKey of 2,4-difluoro-N-(2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)benzamide?
The InChIKey is MBACTHKEPMCGMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16F2N2O/c1-21-7-6-11-2-4-14(8-12(11)10-21)20-17(22)15-5-3-13(18)9-16(15)19/h2-5,8-9H,6-7,10H2,1H3,(H,20,22).
What are the key properties of 2,4-difluoro-N-(2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)benzamide?
2,4-difluoro-N-(2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)benzamide has a molecular weight of 302.32 g/mol, XLogP of 3.20, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-difluoro-N-(2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)benzamide is sourced from PubChem (CID 22597780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).