C17H18FN3O — CID 54022788
1-(3-fluorophenyl)-3-(2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)urea (PubChem CID 54022788) has the molecular formula C17H18FN3O and a molecular weight of 299.35 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-3-(2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)urea.
| Compound Name | 1-(3-fluorophenyl)-3-(2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)urea |
|---|---|
| PubChem CID | 54022788 |
| Molecular Formula | C17H18FN3O |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | 1-(3-fluorophenyl)-3-(2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)urea |
| SMILES | CN1CCc2ccc(NC(=O)Nc3cccc(F)c3)cc2C1 |
| InChI | InChI=1S/C17H18FN3O/c1-21-8-7-12-5-6-16(9-13(12)11-21)20-17(22)19-15-4-2-3-14(18)10-15/h2-6,9-10H,7-8,11H2,1H3,(H2,19,20,22) |
| InChIKey | LABZBPDLBLIUOP-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |