C24H25N3O2 — CID 54334124
1-(2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)-3-(3-phenylmethoxyphenyl)urea (PubChem CID 54334124) has the molecular formula C24H25N3O2 and a molecular weight of 387.48 g/mol. Its IUPAC name is 1-(2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)-3-(3-phenylmethoxyphenyl)urea.
| Compound Name | 1-(2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)-3-(3-phenylmethoxyphenyl)urea |
|---|---|
| PubChem CID | 54334124 |
| Molecular Formula | C24H25N3O2 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | 1-(2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)-3-(3-phenylmethoxyphenyl)urea |
| SMILES | CN1CCc2ccc(NC(=O)Nc3cccc(OCc4ccccc4)c3)cc2C1 |
| InChI | InChI=1S/C24H25N3O2/c1-27-13-12-19-10-11-22(14-20(19)16-27)26-24(28)25-21-8-5-9-23(15-21)29-17-18-6-3-2-4-7-18/h2-11,14-15H,12-13,16-17H2,1H3,(H2,25,26,28) |
| InChIKey | TUGDOGBSELNANB-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |