C24H27N3O3 — CID 172887192
(2S,4S)-N-(2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)-4-phenoxy-1-prop-2-enoylpyrrolidine-2-carboxamide (PubChem CID 172887192) has the molecular formula C24H27N3O3 and a molecular weight of 405.50 g/mol. Its IUPAC name is (2S,4S)-N-(2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)-4-phenoxy-1-prop-2-enoylpyrrolidine-2-carboxamide.
| Compound Name | (2S,4S)-N-(2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)-4-phenoxy-1-prop-2-enoylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 172887192 |
| Molecular Formula | C24H27N3O3 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | (2S,4S)-N-(2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)-4-phenoxy-1-prop-2-enoylpyrrolidine-2-carboxamide |
| SMILES | C=CC(=O)N1C[C@@H](Oc2ccccc2)C[C@H]1C(=O)Nc1ccc2c(c1)CN(C)CC2 |
| InChI | InChI=1S/C24H27N3O3/c1-3-23(28)27-16-21(30-20-7-5-4-6-8-20)14-22(27)24(29)25-19-10-9-17-11-12-26(2)15-18(17)13-19/h3-10,13,21-22H,1,11-12,14-16H2,2H3,(H,25,29)/t21-,22-/m0/s1 |
| InChIKey | HXIBCOHJCKJGPI-VXKWHMMOSA-N |
| XLogP | 2.85 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|