C25H31ClN4O3 — CID 24856462
(2R,4R)-1-N-(4-chlorophenyl)-4-methoxy-1-N-methyl-2-N-(3-methyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl)pyrrolidine-1,2-dicarboxamide (PubChem CID 24856462) has the molecular formula C25H31ClN4O3 and a molecular weight of 471.00 g/mol. Its IUPAC name is (2R,4R)-1-N-(4-chlorophenyl)-4-methoxy-1-N-methyl-2-N-(3-methyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl)pyrrolidine-1,2-dicarboxamide.
| Compound Name | (2R,4R)-1-N-(4-chlorophenyl)-4-methoxy-1-N-methyl-2-N-(3-methyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl)pyrrolidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 24856462 |
| Molecular Formula | C25H31ClN4O3 |
| Molecular Weight | 471.00 g/mol |
| Exact Mass | 470.21 |
| IUPAC Name | (2R,4R)-1-N-(4-chlorophenyl)-4-methoxy-1-N-methyl-2-N-(3-methyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl)pyrrolidine-1,2-dicarboxamide |
| SMILES | CO[C@@H]1C[C@H](C(=O)Nc2ccc3c(c2)CCN(C)CC3)N(C(=O)N(C)c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C25H31ClN4O3/c1-28-12-10-17-4-7-20(14-18(17)11-13-28)27-24(31)23-15-22(33-3)16-30(23)25(32)29(2)21-8-5-19(26)6-9-21/h4-9,14,22-23H,10-13,15-16H2,1-3H3,(H,27,31)/t22-,23-/m1/s1 |
| InChIKey | MIJQKXJSINANGJ-DHIUTWEWSA-N |
| XLogP | 3.65 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.00 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |