C25H31BN4O3 — CID 89337135
CID 89337135 (PubChem CID 89337135) has the molecular formula C25H31BN4O3 and a molecular weight of 446.36 g/mol.
| Compound Name | CID 89337135 |
|---|---|
| PubChem CID | 89337135 |
| Molecular Formula | C25H31BN4O3 |
| Molecular Weight | 446.36 g/mol |
| Exact Mass | 446.25 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(NC(=O)N2CC(OC)CC2C(=O)Nc2ccc3c(c2)CCN(C)CC3C)cc1 |
| InChI | InChI=1S/C25H31BN4O3/c1-16-14-29(2)11-10-17-12-20(8-9-22(16)17)27-24(31)23-13-21(33-3)15-30(23)25(32)28-19-6-4-18(26)5-7-19/h4-9,12,16,21,23H,10-11,13-15H2,1-3H3,(H,27,31)(H,28,32) |
| InChIKey | TWCMOPYBCSVRNW-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.36 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|