C24H28BFN4O3 — CID 89337000
CID 89337000 (PubChem CID 89337000) has the molecular formula C24H28BFN4O3 and a molecular weight of 450.32 g/mol.
| Compound Name | CID 89337000 |
|---|---|
| PubChem CID | 89337000 |
| Molecular Formula | C24H28BFN4O3 |
| Molecular Weight | 450.32 g/mol |
| Exact Mass | 450.22 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(NC(=O)N2CC(OC)CC2C(=O)Nc2cc3c(cc2F)CCN(C)CC3)cc1 |
| InChI | InChI=1S/C24H28BFN4O3/c1-29-9-7-15-11-20(26)21(12-16(15)8-10-29)28-23(31)22-13-19(33-2)14-30(22)24(32)27-18-5-3-17(25)4-6-18/h3-6,11-12,19,22H,7-10,13-14H2,1-2H3,(H,27,32)(H,28,31) |
| InChIKey | OWDOORMPMLDZOV-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.32 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|