C14H19FN4OS — CID 61123946
1-(4-carbamothioyl-1-methylpiperidin-4-yl)-3-(3-fluorophenyl)urea (PubChem CID 61123946) has the molecular formula C14H19FN4OS and a molecular weight of 310.40 g/mol. Its IUPAC name is 1-(4-carbamothioyl-1-methylpiperidin-4-yl)-3-(3-fluorophenyl)urea.
| Compound Name | 1-(4-carbamothioyl-1-methylpiperidin-4-yl)-3-(3-fluorophenyl)urea |
|---|---|
| PubChem CID | 61123946 |
| Molecular Formula | C14H19FN4OS |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | 1-(4-carbamothioyl-1-methylpiperidin-4-yl)-3-(3-fluorophenyl)urea |
| SMILES | CN1CCC(NC(=O)Nc2cccc(F)c2)(C(N)=S)CC1 |
| InChI | InChI=1S/C14H19FN4OS/c1-19-7-5-14(6-8-19,12(16)21)18-13(20)17-11-4-2-3-10(15)9-11/h2-4,9H,5-8H2,1H3,(H2,16,21)(H2,17,18,20) |
| InChIKey | YQYNTRPCXWMQRY-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|