C25H28ClN3O2 — CID 176997319
6-[[3-(3-chloro-2-methylphenyl)-1-prop-2-enoylpyrrolidin-3-yl]amino]-1,3,3-trimethylindol-2-one (PubChem CID 176997319) has the molecular formula C25H28ClN3O2 and a molecular weight of 437.97 g/mol. Its IUPAC name is 6-[[3-(3-chloro-2-methylphenyl)-1-prop-2-enoylpyrrolidin-3-yl]amino]-1,3,3-trimethylindol-2-one.
| Compound Name | 6-[[3-(3-chloro-2-methylphenyl)-1-prop-2-enoylpyrrolidin-3-yl]amino]-1,3,3-trimethylindol-2-one |
|---|---|
| PubChem CID | 176997319 |
| Molecular Formula | C25H28ClN3O2 |
| Molecular Weight | 437.97 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | 6-[[3-(3-chloro-2-methylphenyl)-1-prop-2-enoylpyrrolidin-3-yl]amino]-1,3,3-trimethylindol-2-one |
| SMILES | C=CC(=O)N1CCC(Nc2ccc3c(c2)N(C)C(=O)C3(C)C)(c2cccc(Cl)c2C)C1 |
| InChI | InChI=1S/C25H28ClN3O2/c1-6-22(30)29-13-12-25(15-29,18-8-7-9-20(26)16(18)2)27-17-10-11-19-21(14-17)28(5)23(31)24(19,3)4/h6-11,14,27H,1,12-13,15H2,2-5H3 |
| InChIKey | URWBCQHCJTYHQA-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.97 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|