C24H25Cl2FN4O2 — CID 176996835
N'-[4-[[3-(2,3-dichloro-6-fluorophenyl)-1-prop-2-enoylpyrrolidin-3-yl]amino]-2-formyl-3-methylphenyl]-N,N-dimethylmethanimidamide (PubChem CID 176996835) has the molecular formula C24H25Cl2FN4O2 and a molecular weight of 491.39 g/mol. Its IUPAC name is N'-[4-[[3-(2,3-dichloro-6-fluorophenyl)-1-prop-2-enoylpyrrolidin-3-yl]amino]-2-formyl-3-methylphenyl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[4-[[3-(2,3-dichloro-6-fluorophenyl)-1-prop-2-enoylpyrrolidin-3-yl]amino]-2-formyl-3-methylphenyl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 176996835 |
| Molecular Formula | C24H25Cl2FN4O2 |
| Molecular Weight | 491.39 g/mol |
| Exact Mass | 490.13 |
| IUPAC Name | N'-[4-[[3-(2,3-dichloro-6-fluorophenyl)-1-prop-2-enoylpyrrolidin-3-yl]amino]-2-formyl-3-methylphenyl]-N,N-dimethylmethanimidamide |
| SMILES | C=CC(=O)N1CCC(Nc2ccc(/N=C/N(C)C)c(C=O)c2C)(c2c(F)ccc(Cl)c2Cl)C1 |
| InChI | InChI=1S/C24H25Cl2FN4O2/c1-5-21(33)31-11-10-24(13-31,22-18(27)7-6-17(25)23(22)26)29-19-8-9-20(28-14-30(3)4)16(12-32)15(19)2/h5-9,12,14,29H,1,10-11,13H2,2-4H3/b28-14+ |
| InChIKey | CDJPQNPJABTQJM-CCVNUDIWSA-N |
| XLogP | 5.20 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.39 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|