C22H22Cl2F2N4O — CID 176996937
N-cyclopropyl-N'-[4-[[3-(2,3-dichloro-6-fluorophenyl)pyrrolidin-3-yl]amino]-2-fluoro-6-formylphenyl]-N-methylmethanimidamide (PubChem CID 176996937) has the molecular formula C22H22Cl2F2N4O and a molecular weight of 467.35 g/mol. Its IUPAC name is N-cyclopropyl-N'-[4-[[3-(2,3-dichloro-6-fluorophenyl)pyrrolidin-3-yl]amino]-2-fluoro-6-formylphenyl]-N-methylmethanimidamide.
| Compound Name | N-cyclopropyl-N'-[4-[[3-(2,3-dichloro-6-fluorophenyl)pyrrolidin-3-yl]amino]-2-fluoro-6-formylphenyl]-N-methylmethanimidamide |
|---|---|
| PubChem CID | 176996937 |
| Molecular Formula | C22H22Cl2F2N4O |
| Molecular Weight | 467.35 g/mol |
| Exact Mass | 466.11 |
| IUPAC Name | N-cyclopropyl-N'-[4-[[3-(2,3-dichloro-6-fluorophenyl)pyrrolidin-3-yl]amino]-2-fluoro-6-formylphenyl]-N-methylmethanimidamide |
| SMILES | CN(/C=N/c1c(F)cc(NC2(c3c(F)ccc(Cl)c3Cl)CCNC2)cc1C=O)C1CC1 |
| InChI | InChI=1S/C22H22Cl2F2N4O/c1-30(15-2-3-15)12-28-21-13(10-31)8-14(9-18(21)26)29-22(6-7-27-11-22)19-17(25)5-4-16(23)20(19)24/h4-5,8-10,12,15,27,29H,2-3,6-7,11H2,1H3/b28-12+ |
| InChIKey | SLPGRTYUVCGCNF-KVSWJAHQSA-N |
| XLogP | 5.14 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.35 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|