C23H27Cl2F2N3O — CID 176997390
6-[[3-(2,3-dichloro-6-fluorophenyl)pyrrolidin-3-yl]amino]-4-fluoro-1,3,3-trimethylindol-2-one;ethane (PubChem CID 176997390) has the molecular formula C23H27Cl2F2N3O and a molecular weight of 470.39 g/mol. Its IUPAC name is 6-[[3-(2,3-dichloro-6-fluorophenyl)pyrrolidin-3-yl]amino]-4-fluoro-1,3,3-trimethylindol-2-one;ethane.
| Compound Name | 6-[[3-(2,3-dichloro-6-fluorophenyl)pyrrolidin-3-yl]amino]-4-fluoro-1,3,3-trimethylindol-2-one;ethane |
|---|---|
| PubChem CID | 176997390 |
| Molecular Formula | C23H27Cl2F2N3O |
| Molecular Weight | 470.39 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | 6-[[3-(2,3-dichloro-6-fluorophenyl)pyrrolidin-3-yl]amino]-4-fluoro-1,3,3-trimethylindol-2-one;ethane |
| SMILES | CC.CN1C(=O)C(C)(C)c2c(F)cc(NC3(c4c(F)ccc(Cl)c4Cl)CCNC3)cc21 |
| InChI | InChI=1S/C21H21Cl2F2N3O.C2H6/c1-20(2)16-14(25)8-11(9-15(16)28(3)19(20)29)27-21(6-7-26-10-21)17-13(24)5-4-12(22)18(17)23;1-2/h4-5,8-9,26-27H,6-7,10H2,1-3H3;1-2H3 |
| InChIKey | YPWGPKVLONIPHJ-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.39 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|