C22H19Cl2FN4O2 — CID 176997323
7-[[3-(2,3-dichloro-6-fluorophenyl)-1-prop-2-enoylpyrrolidin-3-yl]amino]-1-methylquinoxalin-2-one (PubChem CID 176997323) has the molecular formula C22H19Cl2FN4O2 and a molecular weight of 461.32 g/mol. Its IUPAC name is 7-[[3-(2,3-dichloro-6-fluorophenyl)-1-prop-2-enoylpyrrolidin-3-yl]amino]-1-methylquinoxalin-2-one.
| Compound Name | 7-[[3-(2,3-dichloro-6-fluorophenyl)-1-prop-2-enoylpyrrolidin-3-yl]amino]-1-methylquinoxalin-2-one |
|---|---|
| PubChem CID | 176997323 |
| Molecular Formula | C22H19Cl2FN4O2 |
| Molecular Weight | 461.32 g/mol |
| Exact Mass | 460.09 |
| IUPAC Name | 7-[[3-(2,3-dichloro-6-fluorophenyl)-1-prop-2-enoylpyrrolidin-3-yl]amino]-1-methylquinoxalin-2-one |
| SMILES | C=CC(=O)N1CCC(Nc2ccc3ncc(=O)n(C)c3c2)(c2c(F)ccc(Cl)c2Cl)C1 |
| InChI | InChI=1S/C22H19Cl2FN4O2/c1-3-18(30)29-9-8-22(12-29,20-15(25)6-5-14(23)21(20)24)27-13-4-7-16-17(10-13)28(2)19(31)11-26-16/h3-7,10-11,27H,1,8-9,12H2,2H3 |
| InChIKey | XUKONRFCUWPKPG-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.32 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|