C21H18Cl2FN3O3 — CID 177346361
2-[7-[[(3S)-3-(2,3-dichloro-6-fluorophenyl)oxolan-3-yl]amino]-1-oxoisoquinolin-2-yl]acetamide (PubChem CID 177346361) has the molecular formula C21H18Cl2FN3O3 and a molecular weight of 450.30 g/mol. Its IUPAC name is 2-[7-[[(3S)-3-(2,3-dichloro-6-fluorophenyl)oxolan-3-yl]amino]-1-oxoisoquinolin-2-yl]acetamide.
| Compound Name | 2-[7-[[(3S)-3-(2,3-dichloro-6-fluorophenyl)oxolan-3-yl]amino]-1-oxoisoquinolin-2-yl]acetamide |
|---|---|
| PubChem CID | 177346361 |
| Molecular Formula | C21H18Cl2FN3O3 |
| Molecular Weight | 450.30 g/mol |
| Exact Mass | 449.07 |
| IUPAC Name | 2-[7-[[(3S)-3-(2,3-dichloro-6-fluorophenyl)oxolan-3-yl]amino]-1-oxoisoquinolin-2-yl]acetamide |
| SMILES | NC(=O)Cn1ccc2ccc(N[C@]3(c4c(F)ccc(Cl)c4Cl)CCOC3)cc2c1=O |
| InChI | InChI=1S/C21H18Cl2FN3O3/c22-15-3-4-16(24)18(19(15)23)21(6-8-30-11-21)26-13-2-1-12-5-7-27(10-17(25)28)20(29)14(12)9-13/h1-5,7,9,26H,6,8,10-11H2,(H2,25,28)/t21-/m1/s1 |
| InChIKey | SMIOOSGXYRUURC-OAQYLSRUSA-N |
| XLogP | 3.66 |
| TPSA | 86.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.30 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|