C26H24Cl2F4N4O2 — CID 176996840
1-[3-(2,3-dichloro-6-fluorophenyl)-3-[[2-(oxan-4-yl)-3-(trifluoromethyl)indazol-6-yl]amino]pyrrolidin-1-yl]prop-2-en-1-one (PubChem CID 176996840) has the molecular formula C26H24Cl2F4N4O2 and a molecular weight of 571.40 g/mol. Its IUPAC name is 1-[3-(2,3-dichloro-6-fluorophenyl)-3-[[2-(oxan-4-yl)-3-(trifluoromethyl)indazol-6-yl]amino]pyrrolidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[3-(2,3-dichloro-6-fluorophenyl)-3-[[2-(oxan-4-yl)-3-(trifluoromethyl)indazol-6-yl]amino]pyrrolidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 176996840 |
| Molecular Formula | C26H24Cl2F4N4O2 |
| Molecular Weight | 571.40 g/mol |
| Exact Mass | 570.12 |
| IUPAC Name | 1-[3-(2,3-dichloro-6-fluorophenyl)-3-[[2-(oxan-4-yl)-3-(trifluoromethyl)indazol-6-yl]amino]pyrrolidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC(Nc2ccc3c(C(F)(F)F)n(C4CCOCC4)nc3c2)(c2c(F)ccc(Cl)c2Cl)C1 |
| InChI | InChI=1S/C26H24Cl2F4N4O2/c1-2-21(37)35-10-9-25(14-35,22-19(29)6-5-18(27)23(22)28)33-15-3-4-17-20(13-15)34-36(24(17)26(30,31)32)16-7-11-38-12-8-16/h2-6,13,16,33H,1,7-12,14H2 |
| InChIKey | QBYSKYKVLQKJPQ-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.40 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|