C24H23Cl2F2N4O2+ — CID 176996975
[3-(2,3-dichloro-6-fluorophenyl)-1-prop-2-enoylpyrrolidin-3-yl]-(8-fluoro-3-methyl-4-oxoquinazolin-6-yl)-dimethylazanium (PubChem CID 176996975) has the molecular formula C24H23Cl2F2N4O2+ and a molecular weight of 508.38 g/mol. Its IUPAC name is [3-(2,3-dichloro-6-fluorophenyl)-1-prop-2-enoylpyrrolidin-3-yl]-(8-fluoro-3-methyl-4-oxoquinazolin-6-yl)-dimethylazanium.
| Compound Name | [3-(2,3-dichloro-6-fluorophenyl)-1-prop-2-enoylpyrrolidin-3-yl]-(8-fluoro-3-methyl-4-oxoquinazolin-6-yl)-dimethylazanium |
|---|---|
| PubChem CID | 176996975 |
| Molecular Formula | C24H23Cl2F2N4O2+ |
| Molecular Weight | 508.38 g/mol |
| Exact Mass | 507.12 |
| IUPAC Name | [3-(2,3-dichloro-6-fluorophenyl)-1-prop-2-enoylpyrrolidin-3-yl]-(8-fluoro-3-methyl-4-oxoquinazolin-6-yl)-dimethylazanium |
| SMILES | C=CC(=O)N1CCC(c2c(F)ccc(Cl)c2Cl)([N+](C)(C)c2cc(F)c3ncn(C)c(=O)c3c2)C1 |
| InChI | InChI=1S/C24H23Cl2F2N4O2/c1-5-19(33)31-9-8-24(12-31,20-17(27)7-6-16(25)21(20)26)32(3,4)14-10-15-22(18(28)11-14)29-13-30(2)23(15)34/h5-7,10-11,13H,1,8-9,12H2,2-4H3/q+1 |
| InChIKey | OAPMVYARBFLTNT-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.38 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|