C21H20Cl2FN5O2 — CID 167487922
1-[4-[[4-(3,4-dichloro-2-fluoroanilino)-7H-pyrrolo[2,3-d]pyrimidin-6-yl]-hydroxymethyl]piperidin-1-yl]prop-2-en-1-one (PubChem CID 167487922) has the molecular formula C21H20Cl2FN5O2 and a molecular weight of 464.33 g/mol. Its IUPAC name is 1-[4-[[4-(3,4-dichloro-2-fluoroanilino)-7H-pyrrolo[2,3-d]pyrimidin-6-yl]-hydroxymethyl]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[[4-(3,4-dichloro-2-fluoroanilino)-7H-pyrrolo[2,3-d]pyrimidin-6-yl]-hydroxymethyl]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 167487922 |
| Molecular Formula | C21H20Cl2FN5O2 |
| Molecular Weight | 464.33 g/mol |
| Exact Mass | 463.10 |
| IUPAC Name | 1-[4-[[4-(3,4-dichloro-2-fluoroanilino)-7H-pyrrolo[2,3-d]pyrimidin-6-yl]-hydroxymethyl]piperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC(C(O)c2cc3c(Nc4ccc(Cl)c(Cl)c4F)ncnc3[nH]2)CC1 |
| InChI | InChI=1S/C21H20Cl2FN5O2/c1-2-16(30)29-7-5-11(6-8-29)19(31)15-9-12-20(25-10-26-21(12)28-15)27-14-4-3-13(22)17(23)18(14)24/h2-4,9-11,19,31H,1,5-8H2,(H2,25,26,27,28) |
| InChIKey | VZDGWHVTYKAGJB-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 94.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.33 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|