C21H22Cl2FN7O2 — CID 156505117
butyl 3-[[4-(3,4-dichloro-2-fluoroanilino)pyrimido[5,4-d]pyrimidin-6-yl]amino]pyrrolidine-1-carboxylate (PubChem CID 156505117) has the molecular formula C21H22Cl2FN7O2 and a molecular weight of 494.36 g/mol. Its IUPAC name is butyl 3-[[4-(3,4-dichloro-2-fluoroanilino)pyrimido[5,4-d]pyrimidin-6-yl]amino]pyrrolidine-1-carboxylate.
| Compound Name | butyl 3-[[4-(3,4-dichloro-2-fluoroanilino)pyrimido[5,4-d]pyrimidin-6-yl]amino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 156505117 |
| Molecular Formula | C21H22Cl2FN7O2 |
| Molecular Weight | 494.36 g/mol |
| Exact Mass | 493.12 |
| IUPAC Name | butyl 3-[[4-(3,4-dichloro-2-fluoroanilino)pyrimido[5,4-d]pyrimidin-6-yl]amino]pyrrolidine-1-carboxylate |
| SMILES | CCCCOC(=O)N1CCC(Nc2ncc3ncnc(Nc4ccc(Cl)c(Cl)c4F)c3n2)C1 |
| InChI | InChI=1S/C21H22Cl2FN7O2/c1-2-3-8-33-21(32)31-7-6-12(10-31)28-20-25-9-15-18(30-20)19(27-11-26-15)29-14-5-4-13(22)16(23)17(14)24/h4-5,9,11-12H,2-3,6-8,10H2,1H3,(H,25,28,30)(H,26,27,29) |
| InChIKey | IYRHWRNCSVPQOC-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 105.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.36 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|