C12H7Cl2FN6 — CID 156532083
4-N-(3,4-dichloro-2-fluorophenyl)pyrimido[5,4-d]pyrimidine-4,6-diamine (PubChem CID 156532083) has the molecular formula C12H7Cl2FN6 and a molecular weight of 325.13 g/mol. Its IUPAC name is 4-N-(3,4-dichloro-2-fluorophenyl)pyrimido[5,4-d]pyrimidine-4,6-diamine.
| Compound Name | 4-N-(3,4-dichloro-2-fluorophenyl)pyrimido[5,4-d]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 156532083 |
| Molecular Formula | C12H7Cl2FN6 |
| Molecular Weight | 325.13 g/mol |
| Exact Mass | 324.01 |
| IUPAC Name | 4-N-(3,4-dichloro-2-fluorophenyl)pyrimido[5,4-d]pyrimidine-4,6-diamine |
| SMILES | Nc1ncc2ncnc(Nc3ccc(Cl)c(Cl)c3F)c2n1 |
| InChI | InChI=1S/C12H7Cl2FN6/c13-5-1-2-6(9(15)8(5)14)20-11-10-7(18-4-19-11)3-17-12(16)21-10/h1-4H,(H2,16,17,21)(H,18,19,20) |
| InChIKey | IDAQQTWLWAXCLD-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 89.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.13 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|