C18H15Cl2FN6 — CID 166538761
6-(1,6-diazaspiro[3.3]heptan-6-yl)-N-(3,4-dichloro-2-fluorophenyl)pyrido[3,2-d]pyrimidin-4-amine (PubChem CID 166538761) has the molecular formula C18H15Cl2FN6 and a molecular weight of 405.26 g/mol. Its IUPAC name is 6-(1,6-diazaspiro[3.3]heptan-6-yl)-N-(3,4-dichloro-2-fluorophenyl)pyrido[3,2-d]pyrimidin-4-amine.
| Compound Name | 6-(1,6-diazaspiro[3.3]heptan-6-yl)-N-(3,4-dichloro-2-fluorophenyl)pyrido[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 166538761 |
| Molecular Formula | C18H15Cl2FN6 |
| Molecular Weight | 405.26 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | 6-(1,6-diazaspiro[3.3]heptan-6-yl)-N-(3,4-dichloro-2-fluorophenyl)pyrido[3,2-d]pyrimidin-4-amine |
| SMILES | Fc1c(Nc2ncnc3ccc(N4CC5(CCN5)C4)nc23)ccc(Cl)c1Cl |
| InChI | InChI=1S/C18H15Cl2FN6/c19-10-1-2-11(15(21)14(10)20)25-17-16-12(22-9-23-17)3-4-13(26-16)27-7-18(8-27)5-6-24-18/h1-4,9,24H,5-8H2,(H,22,23,25) |
| InChIKey | QYSVFPKMAMFGBX-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 65.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.26 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|