C22H22ClFN6O — CID 166539184
1-[4-[4-(3-chloro-2-fluoroanilino)pyrido[3,2-d]pyrimidin-6-yl]-2,2-dimethylpiperazin-1-yl]prop-2-en-1-one (PubChem CID 166539184) has the molecular formula C22H22ClFN6O and a molecular weight of 440.91 g/mol. Its IUPAC name is 1-[4-[4-(3-chloro-2-fluoroanilino)pyrido[3,2-d]pyrimidin-6-yl]-2,2-dimethylpiperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[4-(3-chloro-2-fluoroanilino)pyrido[3,2-d]pyrimidin-6-yl]-2,2-dimethylpiperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 166539184 |
| Molecular Formula | C22H22ClFN6O |
| Molecular Weight | 440.91 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | 1-[4-[4-(3-chloro-2-fluoroanilino)pyrido[3,2-d]pyrimidin-6-yl]-2,2-dimethylpiperazin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCN(c2ccc3ncnc(Nc4cccc(Cl)c4F)c3n2)CC1(C)C |
| InChI | InChI=1S/C22H22ClFN6O/c1-4-18(31)30-11-10-29(12-22(30,2)3)17-9-8-16-20(28-17)21(26-13-25-16)27-15-7-5-6-14(23)19(15)24/h4-9,13H,1,10-12H2,2-3H3,(H,25,26,27) |
| InChIKey | OJQMTVOVVYPVJS-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.91 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|