C22H18ClFN4O — CID 166539918
1-[(1R)-1-[4-(3-chloro-2-fluoroanilino)quinazolin-6-yl]-3-azabicyclo[3.1.0]hexan-3-yl]prop-2-en-1-one (PubChem CID 166539918) has the molecular formula C22H18ClFN4O and a molecular weight of 408.86 g/mol. Its IUPAC name is 1-[(1R)-1-[4-(3-chloro-2-fluoroanilino)quinazolin-6-yl]-3-azabicyclo[3.1.0]hexan-3-yl]prop-2-en-1-one.
| Compound Name | 1-[(1R)-1-[4-(3-chloro-2-fluoroanilino)quinazolin-6-yl]-3-azabicyclo[3.1.0]hexan-3-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 166539918 |
| Molecular Formula | C22H18ClFN4O |
| Molecular Weight | 408.86 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | 1-[(1R)-1-[4-(3-chloro-2-fluoroanilino)quinazolin-6-yl]-3-azabicyclo[3.1.0]hexan-3-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CC2C[C@@]2(c2ccc3ncnc(Nc4cccc(Cl)c4F)c3c2)C1 |
| InChI | InChI=1S/C22H18ClFN4O/c1-2-19(29)28-10-14-9-22(14,11-28)13-6-7-17-15(8-13)21(26-12-25-17)27-18-5-3-4-16(23)20(18)24/h2-8,12,14H,1,9-11H2,(H,25,26,27)/t14?,22-/m0/s1 |
| InChIKey | SCMCZQHCYSSEBB-JDMGRSRBSA-N |
| XLogP | 4.45 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.86 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|