C17H14ClFN4S — CID 164870314
6-(azetidin-3-ylsulfanyl)-N-(3-chloro-2-fluorophenyl)quinazolin-4-amine (PubChem CID 164870314) has the molecular formula C17H14ClFN4S and a molecular weight of 360.85 g/mol. Its IUPAC name is 6-(azetidin-3-ylsulfanyl)-N-(3-chloro-2-fluorophenyl)quinazolin-4-amine.
| Compound Name | 6-(azetidin-3-ylsulfanyl)-N-(3-chloro-2-fluorophenyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 164870314 |
| Molecular Formula | C17H14ClFN4S |
| Molecular Weight | 360.85 g/mol |
| Exact Mass | 360.06 |
| IUPAC Name | 6-(azetidin-3-ylsulfanyl)-N-(3-chloro-2-fluorophenyl)quinazolin-4-amine |
| SMILES | Fc1c(Cl)cccc1Nc1ncnc2ccc(SC3CNC3)cc12 |
| InChI | InChI=1S/C17H14ClFN4S/c18-13-2-1-3-15(16(13)19)23-17-12-6-10(24-11-7-20-8-11)4-5-14(12)21-9-22-17/h1-6,9,11,20H,7-8H2,(H,21,22,23) |
| InChIKey | YLOYPQKBHBVXKB-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.85 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |