C19H18ClFN4 — CID 166540141
N-(3-chloro-2-fluorophenyl)-6-[(3S)-piperidin-3-yl]quinazolin-4-amine (PubChem CID 166540141) has the molecular formula C19H18ClFN4 and a molecular weight of 356.83 g/mol. Its IUPAC name is N-(3-chloro-2-fluorophenyl)-6-[(3S)-piperidin-3-yl]quinazolin-4-amine.
| Compound Name | N-(3-chloro-2-fluorophenyl)-6-[(3S)-piperidin-3-yl]quinazolin-4-amine |
|---|---|
| PubChem CID | 166540141 |
| Molecular Formula | C19H18ClFN4 |
| Molecular Weight | 356.83 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | N-(3-chloro-2-fluorophenyl)-6-[(3S)-piperidin-3-yl]quinazolin-4-amine |
| SMILES | Fc1c(Cl)cccc1Nc1ncnc2ccc([C@@H]3CCCNC3)cc12 |
| InChI | InChI=1S/C19H18ClFN4/c20-15-4-1-5-17(18(15)21)25-19-14-9-12(13-3-2-8-22-10-13)6-7-16(14)23-11-24-19/h1,4-7,9,11,13,22H,2-3,8,10H2,(H,23,24,25)/t13-/m1/s1 |
| InChIKey | JCCOOAZTZVXOGG-CYBMUJFWSA-N |
| XLogP | 4.63 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.83 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |