C24H26ClFN4O2 — CID 166539588
tert-butyl 3-[4-(3-chloro-2-fluoroanilino)quinazolin-6-yl]piperidine-1-carboxylate (PubChem CID 166539588) has the molecular formula C24H26ClFN4O2 and a molecular weight of 456.95 g/mol. Its IUPAC name is tert-butyl 3-[4-(3-chloro-2-fluoroanilino)quinazolin-6-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[4-(3-chloro-2-fluoroanilino)quinazolin-6-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 166539588 |
| Molecular Formula | C24H26ClFN4O2 |
| Molecular Weight | 456.95 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | tert-butyl 3-[4-(3-chloro-2-fluoroanilino)quinazolin-6-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(c2ccc3ncnc(Nc4cccc(Cl)c4F)c3c2)C1 |
| InChI | InChI=1S/C24H26ClFN4O2/c1-24(2,3)32-23(31)30-11-5-6-16(13-30)15-9-10-19-17(12-15)22(28-14-27-19)29-20-8-4-7-18(25)21(20)26/h4,7-10,12,14,16H,5-6,11,13H2,1-3H3,(H,27,28,29) |
| InChIKey | PAMJKJBEKCZTDU-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.95 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |