C23H24ClF2N5O2 — CID 166538629
tert-butyl 3-[4-(5-chloro-2,4-difluoroanilino)pyrido[3,2-d]pyrimidin-6-yl]piperidine-1-carboxylate (PubChem CID 166538629) has the molecular formula C23H24ClF2N5O2 and a molecular weight of 475.93 g/mol. Its IUPAC name is tert-butyl 3-[4-(5-chloro-2,4-difluoroanilino)pyrido[3,2-d]pyrimidin-6-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[4-(5-chloro-2,4-difluoroanilino)pyrido[3,2-d]pyrimidin-6-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 166538629 |
| Molecular Formula | C23H24ClF2N5O2 |
| Molecular Weight | 475.93 g/mol |
| Exact Mass | 475.16 |
| IUPAC Name | tert-butyl 3-[4-(5-chloro-2,4-difluoroanilino)pyrido[3,2-d]pyrimidin-6-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(c2ccc3ncnc(Nc4cc(Cl)c(F)cc4F)c3n2)C1 |
| InChI | InChI=1S/C23H24ClF2N5O2/c1-23(2,3)33-22(32)31-8-4-5-13(11-31)17-6-7-18-20(29-17)21(28-12-27-18)30-19-9-14(24)15(25)10-16(19)26/h6-7,9-10,12-13H,4-5,8,11H2,1-3H3,(H,27,28,30) |
| InChIKey | FHEVDBSEUAJWSY-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.93 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|