C21H20ClF2N5O2 — CID 166539099
tert-butyl 3-[4-(3-chloro-2,4-difluoroanilino)pyrido[3,4-d]pyrimidin-6-yl]azetidine-1-carboxylate (PubChem CID 166539099) has the molecular formula C21H20ClF2N5O2 and a molecular weight of 447.87 g/mol. Its IUPAC name is tert-butyl 3-[4-(3-chloro-2,4-difluoroanilino)pyrido[3,4-d]pyrimidin-6-yl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[4-(3-chloro-2,4-difluoroanilino)pyrido[3,4-d]pyrimidin-6-yl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 166539099 |
| Molecular Formula | C21H20ClF2N5O2 |
| Molecular Weight | 447.87 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | tert-butyl 3-[4-(3-chloro-2,4-difluoroanilino)pyrido[3,4-d]pyrimidin-6-yl]azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(c2cc3c(Nc4ccc(F)c(Cl)c4F)ncnc3cn2)C1 |
| InChI | InChI=1S/C21H20ClF2N5O2/c1-21(2,3)31-20(30)29-8-11(9-29)15-6-12-16(7-25-15)26-10-27-19(12)28-14-5-4-13(23)17(22)18(14)24/h4-7,10-11H,8-9H2,1-3H3,(H,26,27,28) |
| InChIKey | WEUUXWPFJHWAIN-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.87 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|